About 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline
4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline (PubChem CID 62758683) has the molecular formula C10H8ClFN2S
and a molecular weight of 242.71 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline.
Molecular Properties
| Compound Name | 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline |
| PubChem CID | 62758683 |
| Molecular Formula | C10H8ClFN2S |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline |
| SMILES | Fc1cc(Cl)ccc1NCc1cncs1 |
| InChI | InChI=1S/C10H8ClFN2S/c11-7-1-2-10(9(12)3-7)14-5-8-4-13-6-15-8/h1-4,6,14H,5H2 |
| InChIKey | MMKHOFQKCHSWKQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline?
The IUPAC name of 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline (CID 62758683) is 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline.
What is the SMILES notation for 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline?
The canonical SMILES for 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline is Fc1cc(Cl)ccc1NCc1cncs1.
What is the InChIKey of 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline?
The InChIKey is MMKHOFQKCHSWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClFN2S/c11-7-1-2-10(9(12)3-7)14-5-8-4-13-6-15-8/h1-4,6,14H,5H2.
What are the key properties of 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline?
4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline has a molecular weight of 242.71 g/mol, XLogP of 3.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-fluoro-N-(1,3-thiazol-5-ylmethyl)aniline is sourced from PubChem (CID 62758683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).