C11H10N6S — CID 62759060
2-(tetrazol-1-yl)-N-(1,3-thiazol-5-ylmethyl)aniline (PubChem CID 62759060) has the molecular formula C11H10N6S and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-(tetrazol-1-yl)-N-(1,3-thiazol-5-ylmethyl)aniline.
| Compound Name | 2-(tetrazol-1-yl)-N-(1,3-thiazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 62759060 |
| Molecular Formula | C11H10N6S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-(tetrazol-1-yl)-N-(1,3-thiazol-5-ylmethyl)aniline |
| SMILES | c1ccc(-n2cnnn2)c(NCc2cncs2)c1 |
| InChI | InChI=1S/C11H10N6S/c1-2-4-11(17-7-14-15-16-17)10(3-1)13-6-9-5-12-8-18-9/h1-5,7-8,13H,6H2 |
| InChIKey | HSDKYOOVLBNYHS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |