C12H14N2S2 — CID 62759077
2-phenylsulfanyl-N-(1,3-thiazol-5-ylmethyl)ethanamine (PubChem CID 62759077) has the molecular formula C12H14N2S2 and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-phenylsulfanyl-N-(1,3-thiazol-5-ylmethyl)ethanamine.
| Compound Name | 2-phenylsulfanyl-N-(1,3-thiazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62759077 |
| Molecular Formula | C12H14N2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-phenylsulfanyl-N-(1,3-thiazol-5-ylmethyl)ethanamine |
| SMILES | c1ccc(SCCNCc2cncs2)cc1 |
| InChI | InChI=1S/C12H14N2S2/c1-2-4-11(5-3-1)15-7-6-13-8-12-9-14-10-16-12/h1-5,9-10,13H,6-8H2 |
| InChIKey | OECDAEWYXHTHPT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|