2-(1,3-thiazol-5-ylmethylamino)acetic acid

C6H8N2O2S — CID 62760359

IUPAC2-(1,3-thiazol-5-ylmethylamino)acetic acid
SMILESO=C(O)CNCc1cncs1
InChIInChI=1S/C6H8N2O2S/c9-6(10)3-7-1-5-2-8-4-11-5/h2,4,7H,1,3H2,(H,9,10)
InChIKeySGPDTHLRKTTYLH-UHFFFAOYSA-N
MW172.21 g/mol
LogP0.32
Rot. Bonds4

About 2-(1,3-thiazol-5-ylmethylamino)acetic acid

2-(1,3-thiazol-5-ylmethylamino)acetic acid (PubChem CID 62760359) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is 2-(1,3-thiazol-5-ylmethylamino)acetic acid.

Molecular Properties

Compound Name2-(1,3-thiazol-5-ylmethylamino)acetic acid
PubChem CID62760359
Molecular FormulaC6H8N2O2S
Molecular Weight172.21 g/mol
Exact Mass172.03
IUPAC Name2-(1,3-thiazol-5-ylmethylamino)acetic acid
SMILESO=C(O)CNCc1cncs1
InChIInChI=1S/C6H8N2O2S/c9-6(10)3-7-1-5-2-8-4-11-5/h2,4,7H,1,3H2,(H,9,10)
InChIKeySGPDTHLRKTTYLH-UHFFFAOYSA-N
XLogP0.32
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.21
LogP ≤ 50.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(1,3-thiazol-5-ylmethylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-thiazol-5-ylmethylamino)acetic acid?
The IUPAC name of 2-(1,3-thiazol-5-ylmethylamino)acetic acid (CID 62760359) is 2-(1,3-thiazol-5-ylmethylamino)acetic acid.
What is the SMILES notation for 2-(1,3-thiazol-5-ylmethylamino)acetic acid?
The canonical SMILES for 2-(1,3-thiazol-5-ylmethylamino)acetic acid is O=C(O)CNCc1cncs1.
What is the InChIKey of 2-(1,3-thiazol-5-ylmethylamino)acetic acid?
The InChIKey is SGPDTHLRKTTYLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c9-6(10)3-7-1-5-2-8-4-11-5/h2,4,7H,1,3H2,(H,9,10).
What are the key properties of 2-(1,3-thiazol-5-ylmethylamino)acetic acid?
2-(1,3-thiazol-5-ylmethylamino)acetic acid has a molecular weight of 172.21 g/mol, XLogP of 0.32, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-5-ylmethylamino)acetic acid is sourced from PubChem (CID 62760359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).