About methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate
methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate (PubChem CID 62760899) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate.
Molecular Properties
| Compound Name | methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate |
| PubChem CID | 62760899 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate |
| SMILES | COC(=O)CCNCc1cncs1 |
| InChI | InChI=1S/C8H12N2O2S/c1-12-8(11)2-3-9-4-7-5-10-6-13-7/h5-6,9H,2-4H2,1H3 |
| InChIKey | STENAYVSNYWJQJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate?
The IUPAC name of methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate (CID 62760899) is methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate.
What is the SMILES notation for methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate?
The canonical SMILES for methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate is COC(=O)CCNCc1cncs1.
What is the InChIKey of methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate?
The InChIKey is STENAYVSNYWJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-12-8(11)2-3-9-4-7-5-10-6-13-7/h5-6,9H,2-4H2,1H3.
What are the key properties of methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate?
methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate has a molecular weight of 200.26 g/mol, XLogP of 0.80, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1,3-thiazol-5-ylmethylamino)propanoate is sourced from PubChem (CID 62760899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).