C19H20N2O2S — CID 6276155
(E)-3-(4-methoxyphenyl)-N-(1-phenylethylcarbamothioyl)prop-2-enamide (PubChem CID 6276155) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-(1-phenylethylcarbamothioyl)prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-(1-phenylethylcarbamothioyl)prop-2-enamide |
|---|---|
| PubChem CID | 6276155 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-(1-phenylethylcarbamothioyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)NC(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O2S/c1-14(16-6-4-3-5-7-16)20-19(24)21-18(22)13-10-15-8-11-17(23-2)12-9-15/h3-14H,1-2H3,(H2,20,21,22,24)/b13-10+ |
| InChIKey | OGMCOKDDSOCVSQ-JLHYYAGUSA-N |
| XLogP | 3.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|