C13H12N6 — CID 62762707
N-(pyrazin-2-ylmethyl)-4-(1,2,4-triazol-1-yl)aniline (PubChem CID 62762707) has the molecular formula C13H12N6 and a molecular weight of 252.28 g/mol. Its IUPAC name is N-(pyrazin-2-ylmethyl)-4-(1,2,4-triazol-1-yl)aniline.
| Compound Name | N-(pyrazin-2-ylmethyl)-4-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 62762707 |
| Molecular Formula | C13H12N6 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-(pyrazin-2-ylmethyl)-4-(1,2,4-triazol-1-yl)aniline |
| SMILES | c1cnc(CNc2ccc(-n3cncn3)cc2)cn1 |
| InChI | InChI=1S/C13H12N6/c1-3-13(19-10-15-9-18-19)4-2-11(1)17-8-12-7-14-5-6-16-12/h1-7,9-10,17H,8H2 |
| InChIKey | BMQXRMOJCSYBEL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |