C12H16BrN5 — CID 62762781
N-[[1-[(3-bromophenyl)methyl]tetrazol-5-yl]methyl]propan-1-amine (PubChem CID 62762781) has the molecular formula C12H16BrN5 and a molecular weight of 310.20 g/mol. Its IUPAC name is N-[[1-[(3-bromophenyl)methyl]tetrazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(3-bromophenyl)methyl]tetrazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62762781 |
| Molecular Formula | C12H16BrN5 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-[[1-[(3-bromophenyl)methyl]tetrazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnnn1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C12H16BrN5/c1-2-6-14-8-12-15-16-17-18(12)9-10-4-3-5-11(13)7-10/h3-5,7,14H,2,6,8-9H2,1H3 |
| InChIKey | RXXQKTUFGBOIIB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|