C9H12N4 — CID 62763078
2-methyl-3-(pyrazin-2-ylmethylamino)propanenitrile (PubChem CID 62763078) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-methyl-3-(pyrazin-2-ylmethylamino)propanenitrile.
| Compound Name | 2-methyl-3-(pyrazin-2-ylmethylamino)propanenitrile |
|---|---|
| PubChem CID | 62763078 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-methyl-3-(pyrazin-2-ylmethylamino)propanenitrile |
| SMILES | CC(C#N)CNCc1cnccn1 |
| InChI | InChI=1S/C9H12N4/c1-8(4-10)5-12-7-9-6-11-2-3-13-9/h2-3,6,8,12H,5,7H2,1H3 |
| InChIKey | OUYHAVUZJRNURD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |