C14H13ClN4 — CID 62763180
6-chloro-N-(1H-imidazol-5-ylmethyl)-8-methylquinolin-5-amine (PubChem CID 62763180) has the molecular formula C14H13ClN4 and a molecular weight of 272.74 g/mol. Its IUPAC name is 6-chloro-N-(1H-imidazol-5-ylmethyl)-8-methylquinolin-5-amine.
| Compound Name | 6-chloro-N-(1H-imidazol-5-ylmethyl)-8-methylquinolin-5-amine |
|---|---|
| PubChem CID | 62763180 |
| Molecular Formula | C14H13ClN4 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 6-chloro-N-(1H-imidazol-5-ylmethyl)-8-methylquinolin-5-amine |
| SMILES | Cc1cc(Cl)c(NCc2cnc[nH]2)c2cccnc12 |
| InChI | InChI=1S/C14H13ClN4/c1-9-5-12(15)14(11-3-2-4-17-13(9)11)18-7-10-6-16-8-19-10/h2-6,8,18H,7H2,1H3,(H,16,19) |
| InChIKey | SGSIRGRBDOTEPC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |