C11H15F3N2OS — CID 62764568
4-ethyl-2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-1,3-thiazole-5-carbaldehyde (PubChem CID 62764568) has the molecular formula C11H15F3N2OS and a molecular weight of 280.31 g/mol. Its IUPAC name is 4-ethyl-2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-ethyl-2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62764568 |
| Molecular Formula | C11H15F3N2OS |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-ethyl-2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-1,3-thiazole-5-carbaldehyde |
| SMILES | CCc1nc(N(CC(F)(F)F)C(C)C)sc1C=O |
| InChI | InChI=1S/C11H15F3N2OS/c1-4-8-9(5-17)18-10(15-8)16(7(2)3)6-11(12,13)14/h5,7H,4,6H2,1-3H3 |
| InChIKey | HYJBURZGAHTOOB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|