2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid

C12H20N2O2S — CID 62764591

IUPAC2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid
SMILESCCCc1nc(N(CC)CCC)sc1C(=O)O
InChIInChI=1S/C12H20N2O2S/c1-4-7-9-10(11(15)16)17-12(13-9)14(6-3)8-5-2/h4-8H2,1-3H3,(H,15,16)
InChIKeyNTANFXNSXITDKT-UHFFFAOYSA-N
MW256.37 g/mol
LogP3.03
Rot. Bonds7

About 2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid

2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid (PubChem CID 62764591) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid
PubChem CID62764591
Molecular FormulaC12H20N2O2S
Molecular Weight256.37 g/mol
Exact Mass256.12
IUPAC Name2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid
SMILESCCCc1nc(N(CC)CCC)sc1C(=O)O
InChIInChI=1S/C12H20N2O2S/c1-4-7-9-10(11(15)16)17-12(13-9)14(6-3)8-5-2/h4-8H2,1-3H3,(H,15,16)
InChIKeyNTANFXNSXITDKT-UHFFFAOYSA-N
XLogP3.03
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.37
LogP ≤ 53.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid (CID 62764591) is 2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid is CCCc1nc(N(CC)CCC)sc1C(=O)O.
What is the InChIKey of 2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is NTANFXNSXITDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2S/c1-4-7-9-10(11(15)16)17-12(13-9)14(6-3)8-5-2/h4-8H2,1-3H3,(H,15,16).
What are the key properties of 2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid?
2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 256.37 g/mol, XLogP of 3.03, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(propyl)amino]-4-propyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 62764591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).