C13H17F3N2OS — CID 62765085
4-tert-butyl-2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1,3-thiazole-5-carbaldehyde (PubChem CID 62765085) has the molecular formula C13H17F3N2OS and a molecular weight of 306.35 g/mol. Its IUPAC name is 4-tert-butyl-2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-tert-butyl-2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62765085 |
| Molecular Formula | C13H17F3N2OS |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-tert-butyl-2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1,3-thiazole-5-carbaldehyde |
| SMILES | CC(C)(C)c1nc(N(CC(F)(F)F)C2CC2)sc1C=O |
| InChI | InChI=1S/C13H17F3N2OS/c1-12(2,3)10-9(6-19)20-11(17-10)18(8-4-5-8)7-13(14,15)16/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | YOHKOOBJSOXNQJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|