C9H11F3N2OS — CID 62765254
4-ethyl-2-[methyl(2,2,2-trifluoroethyl)amino]-1,3-thiazole-5-carbaldehyde (PubChem CID 62765254) has the molecular formula C9H11F3N2OS and a molecular weight of 252.26 g/mol. Its IUPAC name is 4-ethyl-2-[methyl(2,2,2-trifluoroethyl)amino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-ethyl-2-[methyl(2,2,2-trifluoroethyl)amino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62765254 |
| Molecular Formula | C9H11F3N2OS |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-ethyl-2-[methyl(2,2,2-trifluoroethyl)amino]-1,3-thiazole-5-carbaldehyde |
| SMILES | CCc1nc(N(C)CC(F)(F)F)sc1C=O |
| InChI | InChI=1S/C9H11F3N2OS/c1-3-6-7(4-15)16-8(13-6)14(2)5-9(10,11)12/h4H,3,5H2,1-2H3 |
| InChIKey | HXMGJFPJJWRCKI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|