C10H11F3N2OS — CID 62766260
2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-4-methyl-1,3-thiazole-5-carbaldehyde (PubChem CID 62766260) has the molecular formula C10H11F3N2OS and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-4-methyl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-4-methyl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62766260 |
| Molecular Formula | C10H11F3N2OS |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-4-methyl-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1nc(N(CC(F)(F)F)C2CC2)sc1C=O |
| InChI | InChI=1S/C10H11F3N2OS/c1-6-8(4-16)17-9(14-6)15(7-2-3-7)5-10(11,12)13/h4,7H,2-3,5H2,1H3 |
| InChIKey | OGUXTNTYMCYMPO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|