C19H11F5N2O3 — CID 6276726
4-methyl-3-[5-[(Z)-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 6276726) has the molecular formula C19H11F5N2O3 and a molecular weight of 410.30 g/mol. Its IUPAC name is 4-methyl-3-[5-[(Z)-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-methyl-3-[5-[(Z)-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 6276726 |
| Molecular Formula | C19H11F5N2O3 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 4-methyl-3-[5-[(Z)-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1-c1ccc(/C=N\Nc2c(F)c(F)c(F)c(F)c2F)o1 |
| InChI | InChI=1S/C19H11F5N2O3/c1-8-2-3-9(19(27)28)6-11(8)12-5-4-10(29-12)7-25-26-18-16(23)14(21)13(20)15(22)17(18)24/h2-7,26H,1H3,(H,27,28)/b25-7- |
| InChIKey | PZYSKMVLTLYQHD-ONAMSPKSSA-N |
| XLogP | 5.09 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|