C15H25N3O2S — CID 62767523
N-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-methoxyethanamine (PubChem CID 62767523) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is N-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 62767523 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1sc(N2CCOC3CCCC32)nc1C |
| InChI | InChI=1S/C15H25N3O2S/c1-11-14(10-16-6-8-19-2)21-15(17-11)18-7-9-20-13-5-3-4-12(13)18/h12-13,16H,3-10H2,1-2H3 |
| InChIKey | OWYOVOOEGHXOHK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|