About 1,3,6-trichloropyrene
1,3,6-trichloropyrene (PubChem CID 627676) has the molecular formula C16H7Cl3
and a molecular weight of 305.59 g/mol. Its IUPAC name is 1,3,6-trichloropyrene.
Molecular Properties
| Compound Name | 1,3,6-trichloropyrene |
| PubChem CID | 627676 |
| Molecular Formula | C16H7Cl3 |
| Molecular Weight | 305.59 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | 1,3,6-trichloropyrene |
| SMILES | Clc1ccc2ccc3c(Cl)cc(Cl)c4ccc1c2c34 |
| InChI | InChI=1S/C16H7Cl3/c17-12-6-2-8-1-3-10-13(18)7-14(19)11-5-4-9(12)15(8)16(10)11/h1-7H |
| InChIKey | UDAWGGVUOTXAFF-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.59 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,3,6-trichloropyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,6-trichloropyrene?
The IUPAC name of 1,3,6-trichloropyrene (CID 627676) is 1,3,6-trichloropyrene.
What is the SMILES notation for 1,3,6-trichloropyrene?
The canonical SMILES for 1,3,6-trichloropyrene is Clc1ccc2ccc3c(Cl)cc(Cl)c4ccc1c2c34.
What is the InChIKey of 1,3,6-trichloropyrene?
The InChIKey is UDAWGGVUOTXAFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H7Cl3/c17-12-6-2-8-1-3-10-13(18)7-14(19)11-5-4-9(12)15(8)16(10)11/h1-7H.
What are the key properties of 1,3,6-trichloropyrene?
1,3,6-trichloropyrene has a molecular weight of 305.59 g/mol, XLogP of 6.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,6-trichloropyrene is sourced from PubChem (CID 627676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).