C13H22F3N3OS — CID 62768547
5-[(2-methoxyethylamino)methyl]-4-methyl-N-propyl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine (PubChem CID 62768547) has the molecular formula C13H22F3N3OS and a molecular weight of 325.40 g/mol. Its IUPAC name is 5-[(2-methoxyethylamino)methyl]-4-methyl-N-propyl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-[(2-methoxyethylamino)methyl]-4-methyl-N-propyl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62768547 |
| Molecular Formula | C13H22F3N3OS |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 5-[(2-methoxyethylamino)methyl]-4-methyl-N-propyl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine |
| SMILES | CCCN(CC(F)(F)F)c1nc(C)c(CNCCOC)s1 |
| InChI | InChI=1S/C13H22F3N3OS/c1-4-6-19(9-13(14,15)16)12-18-10(2)11(21-12)8-17-5-7-20-3/h17H,4-9H2,1-3H3 |
| InChIKey | DQXHGMCKGDCNSU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|