C15H25N3OS — CID 62768631
N-[[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-4-methyl-1,3-thiazol-5-yl]methyl]ethanamine (PubChem CID 62768631) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is N-[[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-4-methyl-1,3-thiazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-4-methyl-1,3-thiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62768631 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-[[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-4-methyl-1,3-thiazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1sc(N2CCOC3CCCCC32)nc1C |
| InChI | InChI=1S/C15H25N3OS/c1-3-16-10-14-11(2)17-15(20-14)18-8-9-19-13-7-5-4-6-12(13)18/h12-13,16H,3-10H2,1-2H3 |
| InChIKey | HWMWZNUDXOUOCD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |