C28H25F3N6O — CID 6276879
(E)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile (PubChem CID 6276879) has the molecular formula C28H25F3N6O and a molecular weight of 518.54 g/mol. Its IUPAC name is (E)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6276879 |
| Molecular Formula | C28H25F3N6O |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | (E)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)c2nnc(N3CCOCC3)n2-c2ccccc2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H25F3N6O/c1-19-15-21(20(2)36(19)25-10-6-7-23(17-25)28(29,30)31)16-22(18-32)26-33-34-27(35-11-13-38-14-12-35)37(26)24-8-4-3-5-9-24/h3-10,15-17H,11-14H2,1-2H3/b22-16+ |
| InChIKey | LXPILTLQBQALOL-CJLVFECKSA-N |
| XLogP | 5.59 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|