About N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine
N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine (PubChem CID 62769358) has the molecular formula C11H19N3S2
and a molecular weight of 257.43 g/mol. Its IUPAC name is N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine |
| PubChem CID | 62769358 |
| Molecular Formula | C11H19N3S2 |
| Molecular Weight | 257.43 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine |
| SMILES | CNCc1sc(N(C)C2CCSC2)nc1C |
| InChI | InChI=1S/C11H19N3S2/c1-8-10(6-12-2)16-11(13-8)14(3)9-4-5-15-7-9/h9,12H,4-7H2,1-3H3 |
| InChIKey | SWDKXMVBXVLCNT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine?
The IUPAC name of N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine (CID 62769358) is N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine?
The canonical SMILES for N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine is CNCc1sc(N(C)C2CCSC2)nc1C.
What is the InChIKey of N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine?
The InChIKey is SWDKXMVBXVLCNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3S2/c1-8-10(6-12-2)16-11(13-8)14(3)9-4-5-15-7-9/h9,12H,4-7H2,1-3H3.
What are the key properties of N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine?
N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine has a molecular weight of 257.43 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethyl-5-(methylaminomethyl)-N-(thiolan-3-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 62769358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).