C15H22N4OS — CID 62769379
5-[(2-methoxyethylamino)methyl]-N,4-dimethyl-N-(pyridin-2-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 62769379) has the molecular formula C15H22N4OS and a molecular weight of 306.43 g/mol. Its IUPAC name is 5-[(2-methoxyethylamino)methyl]-N,4-dimethyl-N-(pyridin-2-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-[(2-methoxyethylamino)methyl]-N,4-dimethyl-N-(pyridin-2-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62769379 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 5-[(2-methoxyethylamino)methyl]-N,4-dimethyl-N-(pyridin-2-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | COCCNCc1sc(N(C)Cc2ccccn2)nc1C |
| InChI | InChI=1S/C15H22N4OS/c1-12-14(10-16-8-9-20-3)21-15(18-12)19(2)11-13-6-4-5-7-17-13/h4-7,16H,8-11H2,1-3H3 |
| InChIKey | YRFRDAWMGQLESB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|