C16H25NO2S — CID 62770373
ethyl 2-amino-2-methyl-5-[(2-methylphenyl)methylsulfanyl]pentanoate (PubChem CID 62770373) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is ethyl 2-amino-2-methyl-5-[(2-methylphenyl)methylsulfanyl]pentanoate.
| Compound Name | ethyl 2-amino-2-methyl-5-[(2-methylphenyl)methylsulfanyl]pentanoate |
|---|---|
| PubChem CID | 62770373 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | ethyl 2-amino-2-methyl-5-[(2-methylphenyl)methylsulfanyl]pentanoate |
| SMILES | CCOC(=O)C(C)(N)CCCSCc1ccccc1C |
| InChI | InChI=1S/C16H25NO2S/c1-4-19-15(18)16(3,17)10-7-11-20-12-14-9-6-5-8-13(14)2/h5-6,8-9H,4,7,10-12,17H2,1-3H3 |
| InChIKey | MGDGGPWUFBZQRS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|