About 1-(propylaminomethyl)-2,3-dihydroinden-1-ol
1-(propylaminomethyl)-2,3-dihydroinden-1-ol (PubChem CID 62772754) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(propylaminomethyl)-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 1-(propylaminomethyl)-2,3-dihydroinden-1-ol |
| PubChem CID | 62772754 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(propylaminomethyl)-2,3-dihydroinden-1-ol |
| SMILES | CCCNCC1(O)CCc2ccccc21 |
| InChI | InChI=1S/C13H19NO/c1-2-9-14-10-13(15)8-7-11-5-3-4-6-12(11)13/h3-6,14-15H,2,7-10H2,1H3 |
| InChIKey | HHNZVDSMBVJKJR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(propylaminomethyl)-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(propylaminomethyl)-2,3-dihydroinden-1-ol?
The IUPAC name of 1-(propylaminomethyl)-2,3-dihydroinden-1-ol (CID 62772754) is 1-(propylaminomethyl)-2,3-dihydroinden-1-ol.
What is the SMILES notation for 1-(propylaminomethyl)-2,3-dihydroinden-1-ol?
The canonical SMILES for 1-(propylaminomethyl)-2,3-dihydroinden-1-ol is CCCNCC1(O)CCc2ccccc21.
What is the InChIKey of 1-(propylaminomethyl)-2,3-dihydroinden-1-ol?
The InChIKey is HHNZVDSMBVJKJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-2-9-14-10-13(15)8-7-11-5-3-4-6-12(11)13/h3-6,14-15H,2,7-10H2,1H3.
What are the key properties of 1-(propylaminomethyl)-2,3-dihydroinden-1-ol?
1-(propylaminomethyl)-2,3-dihydroinden-1-ol has a molecular weight of 205.30 g/mol, XLogP of 1.82, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(propylaminomethyl)-2,3-dihydroinden-1-ol is sourced from PubChem (CID 62772754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).