C32H44N4O6 — CID 6277320
(E)-3-(3,4-dimethoxyphenyl)-N-[3-[4-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propyl]piperazin-1-yl]propyl]prop-2-enamide (PubChem CID 6277320) has the molecular formula C32H44N4O6 and a molecular weight of 580.73 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[3-[4-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propyl]piperazin-1-yl]propyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[3-[4-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propyl]piperazin-1-yl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 6277320 |
| Molecular Formula | C32H44N4O6 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[3-[4-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propyl]piperazin-1-yl]propyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCCN2CCN(CCCNC(=O)/C=C/c3ccc(OC)c(OC)c3)CC2)cc1OC |
| InChI | InChI=1S/C32H44N4O6/c1-39-27-11-7-25(23-29(27)41-3)9-13-31(37)33-15-5-17-35-19-21-36(22-20-35)18-6-16-34-32(38)14-10-26-8-12-28(40-2)30(24-26)42-4/h7-14,23-24H,5-6,15-22H2,1-4H3,(H,33,37)(H,34,38)/b13-9+,14-10+ |
| InChIKey | DLAKIYGTEGIMIE-UTLPMFLDSA-N |
| XLogP | 3.08 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|