About 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol
1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol (PubChem CID 62774509) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol |
| PubChem CID | 62774509 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol |
| SMILES | COC(C)(C)CC(C)(O)CNC1CC1 |
| InChI | InChI=1S/C11H23NO2/c1-10(2,14-4)7-11(3,13)8-12-9-5-6-9/h9,12-13H,5-8H2,1-4H3 |
| InChIKey | NOYMGHVHVRIUEK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol?
The IUPAC name of 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol (CID 62774509) is 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol.
What is the SMILES notation for 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol?
The canonical SMILES for 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol is COC(C)(C)CC(C)(O)CNC1CC1.
What is the InChIKey of 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol?
The InChIKey is NOYMGHVHVRIUEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-10(2,14-4)7-11(3,13)8-12-9-5-6-9/h9,12-13H,5-8H2,1-4H3.
What are the key properties of 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol?
1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol has a molecular weight of 201.31 g/mol, XLogP of 1.30, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopropylamino)-4-methoxy-2,4-dimethylpentan-2-ol is sourced from PubChem (CID 62774509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).