C15H29N3OS — CID 62775517
2-ethyl-2-[4-(2-methylpropyl)piperazine-1-carbonyl]butanethioamide (PubChem CID 62775517) has the molecular formula C15H29N3OS and a molecular weight of 299.48 g/mol. Its IUPAC name is 2-ethyl-2-[4-(2-methylpropyl)piperazine-1-carbonyl]butanethioamide.
| Compound Name | 2-ethyl-2-[4-(2-methylpropyl)piperazine-1-carbonyl]butanethioamide |
|---|---|
| PubChem CID | 62775517 |
| Molecular Formula | C15H29N3OS |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-ethyl-2-[4-(2-methylpropyl)piperazine-1-carbonyl]butanethioamide |
| SMILES | CCC(CC)(C(=O)N1CCN(CC(C)C)CC1)C(N)=S |
| InChI | InChI=1S/C15H29N3OS/c1-5-15(6-2,13(16)20)14(19)18-9-7-17(8-10-18)11-12(3)4/h12H,5-11H2,1-4H3,(H2,16,20) |
| InChIKey | FLPKSEXJYGDBKU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|