C28H34N3O2+ — CID 6277726
3-[3-ethyl-2-[(E,3Z)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzimidazol-1-ium-1-yl]propyl acetate (PubChem CID 6277726) has the molecular formula C28H34N3O2+ and a molecular weight of 444.60 g/mol. Its IUPAC name is 3-[3-ethyl-2-[(E,3Z)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzimidazol-1-ium-1-yl]propyl acetate.
| Compound Name | 3-[3-ethyl-2-[(E,3Z)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzimidazol-1-ium-1-yl]propyl acetate |
|---|---|
| PubChem CID | 6277726 |
| Molecular Formula | C28H34N3O2+ |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 3-[3-ethyl-2-[(E,3Z)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzimidazol-1-ium-1-yl]propyl acetate |
| SMILES | CCn1c(/C=C/C=C2\N(C)c3ccccc3C2(C)C)[n+](CCCOC(C)=O)c2ccccc21 |
| InChI | InChI=1S/C28H34N3O2/c1-6-30-24-15-9-10-16-25(24)31(19-12-20-33-21(2)32)27(30)18-11-17-26-28(3,4)22-13-7-8-14-23(22)29(26)5/h7-11,13-18H,6,12,19-20H2,1-5H3/q+1 |
| InChIKey | QZZFOXZJYCETTF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|