About 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole
5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole (PubChem CID 6277728) has the molecular formula C18H14F3NS
and a molecular weight of 333.38 g/mol. Its IUPAC name is 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole |
| PubChem CID | 6277728 |
| Molecular Formula | C18H14F3NS |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole |
| SMILES | Cc1cc2nc(/C=C/c3ccc(C(F)(F)F)cc3)sc2cc1C |
| InChI | InChI=1S/C18H14F3NS/c1-11-9-15-16(10-12(11)2)23-17(22-15)8-5-13-3-6-14(7-4-13)18(19,20)21/h3-10H,1-2H3/b8-5+ |
| InChIKey | CJXCBMDJIBCAET-VMPITWQZSA-N |
| XLogP | 6.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole?
The IUPAC name of 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole (CID 6277728) is 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole.
What is the SMILES notation for 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole?
The canonical SMILES for 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole is Cc1cc2nc(/C=C/c3ccc(C(F)(F)F)cc3)sc2cc1C.
What is the InChIKey of 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole?
The InChIKey is CJXCBMDJIBCAET-VMPITWQZSA-N. The full InChI is InChI=1S/C18H14F3NS/c1-11-9-15-16(10-12(11)2)23-17(22-15)8-5-13-3-6-14(7-4-13)18(19,20)21/h3-10H,1-2H3/b8-5+.
What are the key properties of 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole?
5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole has a molecular weight of 333.38 g/mol, XLogP of 6.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-benzothiazole is sourced from PubChem (CID 6277728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).