About 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide
2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide (PubChem CID 62781010) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide |
| PubChem CID | 62781010 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCCC(C)C1N |
| InChI | InChI=1S/C13H26N2O/c1-4-5-9-15(3)13(16)11-8-6-7-10(2)12(11)14/h10-12H,4-9,14H2,1-3H3 |
| InChIKey | MQQCUYXOOYQFQW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide?
The IUPAC name of 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide (CID 62781010) is 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide.
What is the SMILES notation for 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide?
The canonical SMILES for 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide is CCCCN(C)C(=O)C1CCCC(C)C1N.
What is the InChIKey of 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide?
The InChIKey is MQQCUYXOOYQFQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c1-4-5-9-15(3)13(16)11-8-6-7-10(2)12(11)14/h10-12H,4-9,14H2,1-3H3.
What are the key properties of 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide?
2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide has a molecular weight of 226.36 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-butyl-N,3-dimethylcyclohexane-1-carboxamide is sourced from PubChem (CID 62781010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).