About 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide
2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide (PubChem CID 62781998) has the molecular formula C10H17F3N2O
and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide |
| PubChem CID | 62781998 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide |
| SMILES | CC1CCCC(C(=O)NCC(F)(F)F)C1N |
| InChI | InChI=1S/C10H17F3N2O/c1-6-3-2-4-7(8(6)14)9(16)15-5-10(11,12)13/h6-8H,2-5,14H2,1H3,(H,15,16) |
| InChIKey | YNKXMZGDTBECKJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide?
The IUPAC name of 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide (CID 62781998) is 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide.
What is the SMILES notation for 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide?
The canonical SMILES for 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide is CC1CCCC(C(=O)NCC(F)(F)F)C1N.
What is the InChIKey of 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide?
The InChIKey is YNKXMZGDTBECKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O/c1-6-3-2-4-7(8(6)14)9(16)15-5-10(11,12)13/h6-8H,2-5,14H2,1H3,(H,15,16).
What are the key properties of 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide?
2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide has a molecular weight of 238.25 g/mol, XLogP of 1.43, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-methyl-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide is sourced from PubChem (CID 62781998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).