C17H17N3 — CID 62783291
1-quinolin-3-yl-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 62783291) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-quinolin-3-yl-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 1-quinolin-3-yl-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 62783291 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-quinolin-3-yl-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | NC1CCCc2c1ccn2-c1cnc2ccccc2c1 |
| InChI | InChI=1S/C17H17N3/c18-15-5-3-7-17-14(15)8-9-20(17)13-10-12-4-1-2-6-16(12)19-11-13/h1-2,4,6,8-11,15H,3,5,7,18H2 |
| InChIKey | OXCRQLFRBNQJOX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |