C12H15F2NO — CID 62783803
N-[2-(3,5-difluorophenoxy)propyl]cyclopropanamine (PubChem CID 62783803) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenoxy)propyl]cyclopropanamine.
| Compound Name | N-[2-(3,5-difluorophenoxy)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 62783803 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-[2-(3,5-difluorophenoxy)propyl]cyclopropanamine |
| SMILES | CC(CNC1CC1)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H15F2NO/c1-8(7-15-11-2-3-11)16-12-5-9(13)4-10(14)6-12/h4-6,8,11,15H,2-3,7H2,1H3 |
| InChIKey | VHEIYKFIACCYPK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |