About 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine
7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine (PubChem CID 62784228) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine.
Molecular Properties
| Compound Name | 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine |
| PubChem CID | 62784228 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine |
| SMILES | Nc1cc2c(nn1)CCOC2 |
| InChI | InChI=1S/C7H9N3O/c8-7-3-5-4-11-2-1-6(5)9-10-7/h3H,1-2,4H2,(H2,8,10) |
| InChIKey | IAOIPFIUDFGSJP-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine?
The IUPAC name of 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine (CID 62784228) is 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine.
What is the SMILES notation for 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine?
The canonical SMILES for 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine is Nc1cc2c(nn1)CCOC2.
What is the InChIKey of 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine?
The InChIKey is IAOIPFIUDFGSJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c8-7-3-5-4-11-2-1-6(5)9-10-7/h3H,1-2,4H2,(H2,8,10).
What are the key properties of 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine?
7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine has a molecular weight of 151.17 g/mol, XLogP of 0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-amine is sourced from PubChem (CID 62784228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).