About N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine
N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine (PubChem CID 62784526) has the molecular formula C15H19F2NO2
and a molecular weight of 283.32 g/mol. Its IUPAC name is N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine |
| PubChem CID | 62784526 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine |
| SMILES | Fc1cc(F)cc(OCC2CCC(CNC3CC3)O2)c1 |
| InChI | InChI=1S/C15H19F2NO2/c16-10-5-11(17)7-15(6-10)19-9-14-4-3-13(20-14)8-18-12-1-2-12/h5-7,12-14,18H,1-4,8-9H2 |
| InChIKey | UWDMCDJYCIFSHU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine?
The IUPAC name of N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine (CID 62784526) is N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine.
What is the SMILES notation for N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine?
The canonical SMILES for N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine is Fc1cc(F)cc(OCC2CCC(CNC3CC3)O2)c1.
What is the InChIKey of N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine?
The InChIKey is UWDMCDJYCIFSHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2NO2/c16-10-5-11(17)7-15(6-10)19-9-14-4-3-13(20-14)8-18-12-1-2-12/h5-7,12-14,18H,1-4,8-9H2.
What are the key properties of N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine?
N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine has a molecular weight of 283.32 g/mol, XLogP of 2.64, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-[(3,5-difluorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine is sourced from PubChem (CID 62784526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).