About 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol
7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 62784765) has the molecular formula C9H16O5S
and a molecular weight of 236.29 g/mol. Its IUPAC name is 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol.
Molecular Properties
| Compound Name | 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol |
| PubChem CID | 62784765 |
| Molecular Formula | C9H16O5S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | CS(=O)(=O)C1CC2(CCC1O)OCCO2 |
| InChI | InChI=1S/C9H16O5S/c1-15(11,12)8-6-9(3-2-7(8)10)13-4-5-14-9/h7-8,10H,2-6H2,1H3 |
| InChIKey | LTRJTMCQYHTTQH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol?
The IUPAC name of 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol (CID 62784765) is 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol.
What is the SMILES notation for 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol?
The canonical SMILES for 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol is CS(=O)(=O)C1CC2(CCC1O)OCCO2.
What is the InChIKey of 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol?
The InChIKey is LTRJTMCQYHTTQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5S/c1-15(11,12)8-6-9(3-2-7(8)10)13-4-5-14-9/h7-8,10H,2-6H2,1H3.
What are the key properties of 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol?
7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol has a molecular weight of 236.29 g/mol, XLogP of -0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylsulfonyl-1,4-dioxaspiro[4.5]decan-8-ol is sourced from PubChem (CID 62784765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).