C14H22N6O2 — CID 627850
4,6-dimorpholin-4-yl-N-prop-2-enyl-1,3,5-triazin-2-amine (PubChem CID 627850) has the molecular formula C14H22N6O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 4,6-dimorpholin-4-yl-N-prop-2-enyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dimorpholin-4-yl-N-prop-2-enyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 627850 |
| Molecular Formula | C14H22N6O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 4,6-dimorpholin-4-yl-N-prop-2-enyl-1,3,5-triazin-2-amine |
| SMILES | C=CCNc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C14H22N6O2/c1-2-3-15-12-16-13(19-4-8-21-9-5-19)18-14(17-12)20-6-10-22-11-7-20/h2H,1,3-11H2,(H,15,16,17,18) |
| InChIKey | MTKNDJWEGOPQOR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|