C14H12F3NO — CID 62785083
N-[2-(3,5-difluorophenoxy)ethyl]-4-fluoroaniline (PubChem CID 62785083) has the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenoxy)ethyl]-4-fluoroaniline.
| Compound Name | N-[2-(3,5-difluorophenoxy)ethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 62785083 |
| Molecular Formula | C14H12F3NO |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-[2-(3,5-difluorophenoxy)ethyl]-4-fluoroaniline |
| SMILES | Fc1ccc(NCCOc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C14H12F3NO/c15-10-1-3-13(4-2-10)18-5-6-19-14-8-11(16)7-12(17)9-14/h1-4,7-9,18H,5-6H2 |
| InChIKey | NTABUVSHIJUISL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|