C14H15N3O2 — CID 62785286
methyl 2-[(2-methylpyrimidin-4-yl)amino]-2-phenylacetate (PubChem CID 62785286) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is methyl 2-[(2-methylpyrimidin-4-yl)amino]-2-phenylacetate.
| Compound Name | methyl 2-[(2-methylpyrimidin-4-yl)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 62785286 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | methyl 2-[(2-methylpyrimidin-4-yl)amino]-2-phenylacetate |
| SMILES | COC(=O)C(Nc1ccnc(C)n1)c1ccccc1 |
| InChI | InChI=1S/C14H15N3O2/c1-10-15-9-8-12(16-10)17-13(14(18)19-2)11-6-4-3-5-7-11/h3-9,13H,1-2H3,(H,15,16,17) |
| InChIKey | NXSWNQZRIYKFNP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |