About 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine
6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine (PubChem CID 62785537) has the molecular formula C17H22N4
and a molecular weight of 282.39 g/mol. Its IUPAC name is 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine.
Molecular Properties
| Compound Name | 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine |
| PubChem CID | 62785537 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine |
| SMILES | CCCNc1cc2c(nn1)CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C17H22N4/c1-2-9-18-17-11-15-13-21(10-8-16(15)19-20-17)12-14-6-4-3-5-7-14/h3-7,11H,2,8-10,12-13H2,1H3,(H,18,20) |
| InChIKey | IDWVQYKQSJZYRJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine?
The IUPAC name of 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine (CID 62785537) is 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine.
What is the SMILES notation for 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine?
The canonical SMILES for 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine is CCCNc1cc2c(nn1)CCN(Cc1ccccc1)C2.
What is the InChIKey of 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine?
The InChIKey is IDWVQYKQSJZYRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4/c1-2-9-18-17-11-15-13-21(10-8-16(15)19-20-17)12-14-6-4-3-5-7-14/h3-7,11H,2,8-10,12-13H2,1H3,(H,18,20).
What are the key properties of 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine?
6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine has a molecular weight of 282.39 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-N-propyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-3-amine is sourced from PubChem (CID 62785537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).