C10H21N3 — CID 62785558
N-(azetidin-3-yl)-N,1-dimethylpiperidin-3-amine (PubChem CID 62785558) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is N-(azetidin-3-yl)-N,1-dimethylpiperidin-3-amine.
| Compound Name | N-(azetidin-3-yl)-N,1-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 62785558 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | N-(azetidin-3-yl)-N,1-dimethylpiperidin-3-amine |
| SMILES | CN1CCCC(N(C)C2CNC2)C1 |
| InChI | InChI=1S/C10H21N3/c1-12-5-3-4-9(8-12)13(2)10-6-11-7-10/h9-11H,3-8H2,1-2H3 |
| InChIKey | DQAVPXLNMZOOTH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |