C15H12F2O2S — CID 62785613
2-(3,5-difluorophenoxy)-1-(4-methylsulfanylphenyl)ethanone (PubChem CID 62785613) has the molecular formula C15H12F2O2S and a molecular weight of 294.32 g/mol. Its IUPAC name is 2-(3,5-difluorophenoxy)-1-(4-methylsulfanylphenyl)ethanone.
| Compound Name | 2-(3,5-difluorophenoxy)-1-(4-methylsulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 62785613 |
| Molecular Formula | C15H12F2O2S |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-(3,5-difluorophenoxy)-1-(4-methylsulfanylphenyl)ethanone |
| SMILES | CSc1ccc(C(=O)COc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C15H12F2O2S/c1-20-14-4-2-10(3-5-14)15(18)9-19-13-7-11(16)6-12(17)8-13/h2-8H,9H2,1H3 |
| InChIKey | VVOXPJBQUICHOU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |