About N-methyl-5H-indeno[1,2-c]pyridazin-3-amine
N-methyl-5H-indeno[1,2-c]pyridazin-3-amine (PubChem CID 62785721) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is N-methyl-5H-indeno[1,2-c]pyridazin-3-amine.
Molecular Properties
| Compound Name | N-methyl-5H-indeno[1,2-c]pyridazin-3-amine |
| PubChem CID | 62785721 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-methyl-5H-indeno[1,2-c]pyridazin-3-amine |
| SMILES | CNc1cc2c(nn1)-c1ccccc1C2 |
| InChI | InChI=1S/C12H11N3/c1-13-11-7-9-6-8-4-2-3-5-10(8)12(9)15-14-11/h2-5,7H,6H2,1H3,(H,13,14) |
| InChIKey | QJJIVZSMCYAONW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-5H-indeno[1,2-c]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-5H-indeno[1,2-c]pyridazin-3-amine?
The IUPAC name of N-methyl-5H-indeno[1,2-c]pyridazin-3-amine (CID 62785721) is N-methyl-5H-indeno[1,2-c]pyridazin-3-amine.
What is the SMILES notation for N-methyl-5H-indeno[1,2-c]pyridazin-3-amine?
The canonical SMILES for N-methyl-5H-indeno[1,2-c]pyridazin-3-amine is CNc1cc2c(nn1)-c1ccccc1C2.
What is the InChIKey of N-methyl-5H-indeno[1,2-c]pyridazin-3-amine?
The InChIKey is QJJIVZSMCYAONW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3/c1-13-11-7-9-6-8-4-2-3-5-10(8)12(9)15-14-11/h2-5,7H,6H2,1H3,(H,13,14).
What are the key properties of N-methyl-5H-indeno[1,2-c]pyridazin-3-amine?
N-methyl-5H-indeno[1,2-c]pyridazin-3-amine has a molecular weight of 197.24 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-5H-indeno[1,2-c]pyridazin-3-amine is sourced from PubChem (CID 62785721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).