About 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline
2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline (PubChem CID 62785737) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 62785737 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline |
| SMILES | c1ccc2c(c1)CCN(C1CNC1)C2 |
| InChI | InChI=1S/C12H16N2/c1-2-4-11-9-14(12-7-13-8-12)6-5-10(11)3-1/h1-4,12-13H,5-9H2 |
| InChIKey | VLICTZOMWSSISN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline (CID 62785737) is 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline is c1ccc2c(c1)CCN(C1CNC1)C2.
What is the InChIKey of 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline?
The InChIKey is VLICTZOMWSSISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-2-4-11-9-14(12-7-13-8-12)6-5-10(11)3-1/h1-4,12-13H,5-9H2.
What are the key properties of 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline?
2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline has a molecular weight of 188.27 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-3-yl)-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 62785737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).