About N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine
N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 62786136) has the molecular formula C11H11F2NO
and a molecular weight of 211.21 g/mol. Its IUPAC name is N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine |
| PubChem CID | 62786136 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | Fc1cc(F)c2c(c1)OCC2NC1CC1 |
| InChI | InChI=1S/C11H11F2NO/c12-6-3-8(13)11-9(14-7-1-2-7)5-15-10(11)4-6/h3-4,7,9,14H,1-2,5H2 |
| InChIKey | FYLIWFALKWQJII-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine?
The IUPAC name of N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine (CID 62786136) is N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine.
What is the SMILES notation for N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine?
The canonical SMILES for N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine is Fc1cc(F)c2c(c1)OCC2NC1CC1.
What is the InChIKey of N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine?
The InChIKey is FYLIWFALKWQJII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO/c12-6-3-8(13)11-9(14-7-1-2-7)5-15-10(11)4-6/h3-4,7,9,14H,1-2,5H2.
What are the key properties of N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine?
N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine has a molecular weight of 211.21 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-4,6-difluoro-2,3-dihydro-1-benzofuran-3-amine is sourced from PubChem (CID 62786136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).