About oxolan-2-ylmethyl (E)-octadec-9-enoate
oxolan-2-ylmethyl (E)-octadec-9-enoate (PubChem CID 6278622) has the molecular formula C23H42O3
and a molecular weight of 366.59 g/mol. Its IUPAC name is oxolan-2-ylmethyl (E)-octadec-9-enoate.
Molecular Properties
| Compound Name | oxolan-2-ylmethyl (E)-octadec-9-enoate |
| PubChem CID | 6278622 |
| Molecular Formula | C23H42O3 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | oxolan-2-ylmethyl (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OCC1CCCO1 |
| InChI | InChI=1S/C23H42O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-23(24)26-21-22-18-17-20-25-22/h9-10,22H,2-8,11-21H2,1H3/b10-9+ |
| InChIKey | GIPDEPRRXIBGNF-MDZDMXLPSA-N |
| XLogP | 6.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oxolan-2-ylmethyl (E)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-ylmethyl (E)-octadec-9-enoate?
The IUPAC name of oxolan-2-ylmethyl (E)-octadec-9-enoate (CID 6278622) is oxolan-2-ylmethyl (E)-octadec-9-enoate.
What is the SMILES notation for oxolan-2-ylmethyl (E)-octadec-9-enoate?
The canonical SMILES for oxolan-2-ylmethyl (E)-octadec-9-enoate is CCCCCCCC/C=C/CCCCCCCC(=O)OCC1CCCO1.
What is the InChIKey of oxolan-2-ylmethyl (E)-octadec-9-enoate?
The InChIKey is GIPDEPRRXIBGNF-MDZDMXLPSA-N. The full InChI is InChI=1S/C23H42O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-23(24)26-21-22-18-17-20-25-22/h9-10,22H,2-8,11-21H2,1H3/b10-9+.
What are the key properties of oxolan-2-ylmethyl (E)-octadec-9-enoate?
oxolan-2-ylmethyl (E)-octadec-9-enoate has a molecular weight of 366.59 g/mol, XLogP of 6.75, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-ylmethyl (E)-octadec-9-enoate is sourced from PubChem (CID 6278622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).