C9H19N3O — CID 62786505
2-[azetidin-3-yl(ethyl)amino]-N,N-dimethylacetamide (PubChem CID 62786505) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-[azetidin-3-yl(ethyl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[azetidin-3-yl(ethyl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 62786505 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 2-[azetidin-3-yl(ethyl)amino]-N,N-dimethylacetamide |
| SMILES | CCN(CC(=O)N(C)C)C1CNC1 |
| InChI | InChI=1S/C9H19N3O/c1-4-12(8-5-10-6-8)7-9(13)11(2)3/h8,10H,4-7H2,1-3H3 |
| InChIKey | QLTTWWSCMSLSHI-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |