C15H17N3OS — CID 62786689
(2-amino-1,3-thiazol-4-yl)-(2-benzylpyrrolidin-1-yl)methanone (PubChem CID 62786689) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-4-yl)-(2-benzylpyrrolidin-1-yl)methanone.
| Compound Name | (2-amino-1,3-thiazol-4-yl)-(2-benzylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 62786689 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (2-amino-1,3-thiazol-4-yl)-(2-benzylpyrrolidin-1-yl)methanone |
| SMILES | Nc1nc(C(=O)N2CCCC2Cc2ccccc2)cs1 |
| InChI | InChI=1S/C15H17N3OS/c16-15-17-13(10-20-15)14(19)18-8-4-7-12(18)9-11-5-2-1-3-6-11/h1-3,5-6,10,12H,4,7-9H2,(H2,16,17) |
| InChIKey | ZYHCTRLIKAMBPU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |