C13H17Cl2N — CID 62788342
1-(2,3-dichlorophenyl)-4-methylcyclohexan-1-amine (PubChem CID 62788342) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-4-methylcyclohexan-1-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-4-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 62788342 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-4-methylcyclohexan-1-amine |
| SMILES | CC1CCC(N)(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C13H17Cl2N/c1-9-5-7-13(16,8-6-9)10-3-2-4-11(14)12(10)15/h2-4,9H,5-8,16H2,1H3 |
| InChIKey | KYNJDNPJTIZYQY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |